Products 19368-09-3

CAS 19368-09-3 is the registry number for 2-((3-Carboxyphenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3-carboxyphenyl)carbamoyl]benzoic acid (CAS 19368-09-3) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 2-[(3-carboxyphenyl)carbamoyl]benzoic acid. InChIKey: DAIJYESEGBNTJK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO5
Molecular weight285.25 g/mol
IUPAC name2-[(3-carboxyphenyl)carbamoyl]benzoic acid
InChIKeyDAIJYESEGBNTJK-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)