CAS 926256-19-1 appears in our catalog under these names: 2-[(1,3-Benzodioxol-5-ylcarbonyl)amino]benzoic acid, 95%, 2-(Benzo(d)(1,3)dioxole-5-carboxamido)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(1,3-benzodioxole-5-carbonylamino)benzoic acid (CAS 926256-19-1) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 2-(1,3-benzodioxole-5-carbonylamino)benzoic acid. InChIKey: KHNDNNLPWSGSLS-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 2-(1,3-benzodioxole-5-carbonylamino)benzoic acid |
| InChIKey | KHNDNNLPWSGSLS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)NC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)