Products 85590-85-8
CAS 85590-85-8 is the registry number for 1-(Benzo(d)(1,3)dioxol-5-yl)-2-(4-nitrophenyl)ethanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
1-(1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)ethanone (CAS 85590-85-8) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)ethanone. InChIKey: SIYSHNUTGKYGHH-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(4-nitrophenyl)ethanone |
| InChIKey | SIYSHNUTGKYGHH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)CC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)