Products 56419-89-7
CAS 56419-89-7 appears in our catalog under these names: 4-(4-Carboxybenzamido)benzoic acid, 98%, 98%, 4-(4-Carboxybenzamido)benzoic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
4-[(4-carboxyphenyl)carbamoyl]benzoic acid (CAS 56419-89-7) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 4-[(4-carboxyphenyl)carbamoyl]benzoic acid. InChIKey: WPQIUQXWDUZDBI-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)carbamoyl]benzoic acid |
| InChIKey | WPQIUQXWDUZDBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)