CAS 63768-47-8 is the registry number for 5,6-Dihydro-7,8-dimethyl-4,5-dioxo-4H-pyrano(3,2-c)quinoline-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid (CAS 63768-47-8) is a chemical compound with the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. IUPAC name: 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid. InChIKey: KKCFYNQIBLXNSC-UHFFFAOYSA-N.
| Molecular formula | C15H11NO5 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| InChIKey | KKCFYNQIBLXNSC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C3=C(C(=O)C=C(O3)C(=O)O)C(=O)N2)C |
Computed by PubChem (NCBI)