CAS 14561-40-1 is the registry number for Tranylcypromine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-2-phenylcyclopropane-1-carbohydrazide (CAS 14561-40-1) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: trans-(1S,2S)-2-phenylcyclopropane-1-carbohydrazide. InChIKey: LVPLGMIOSVEITG-BDAKNGLRSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | trans-(1S,2S)-2-phenylcyclopropane-1-carbohydrazide |
| InChIKey | LVPLGMIOSVEITG-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)