CAS 14814-55-2 is the registry number for 2-Phenylcyclopropanecarbohydrazide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-phenylcyclopropane-1-carbohydrazide (CAS 14814-55-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 2-phenylcyclopropane-1-carbohydrazide. InChIKey: LVPLGMIOSVEITG-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-phenylcyclopropane-1-carbohydrazide |
| InChIKey | LVPLGMIOSVEITG-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)