CAS 145852-76-2 appears in our catalog under these names: (2R,3S,4R)–4–(benzyloxy)–2–((benzyloxy)methyl)–3,4–dihydro–2H–pyran–3–ol, 3,6-Di-O-benzyl-D-glucal. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 1g, 2000mg.
(2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-ol (CAS 145852-76-2) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: (2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-ol. InChIKey: KUSSRSMLTQREOG-AQNXPRMDSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (2R,3S,4R)-4-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran-3-ol |
| InChIKey | KUSSRSMLTQREOG-AQNXPRMDSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@@H](C=CO2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)