Products 1459197-75-1
CAS 1459197-75-1 is the registry number for 4,4'-(2,5-Divinyl-1,4-phenylene)dipyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,5-bis(ethenyl)-4-pyridin-4-ylphenyl]pyridine (CAS 1459197-75-1) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 4-[2,5-bis(ethenyl)-4-pyridin-4-ylphenyl]pyridine. InChIKey: MNFSTDOLFVIYII-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-[2,5-bis(ethenyl)-4-pyridin-4-ylphenyl]pyridine |
| InChIKey | MNFSTDOLFVIYII-UHFFFAOYSA-N |
| SMILES | C=CC1=CC(=C(C=C1C2=CC=NC=C2)C=C)C3=CC=NC=C3 |
Computed by PubChem (NCBI)