CAS 324741-46-0 is the registry number for 2-([1,1'-Biphenyl]-4-yl)-6-methylimidazo[1,2-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridine (CAS 324741-46-0) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridine. InChIKey: NEFHGQHEGWHLQX-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 6-methyl-2-(4-phenylphenyl)imidazo[1,2-a]pyridine |
| InChIKey | NEFHGQHEGWHLQX-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)