CAS 3095-81-6 appears in our catalog under these names: 1,4–Bis(2–(pyridin–4–yl)vinyl)benzene, 1,4-Bis(2-(pyridin-4-yl)vinyl)benzene 98%, 1,4-Bis(2-(pyridin-4-yl)vinyl)benzene, 98%, 98%, 1,4-Bis(2-(pyridin-4-yl)vinyl)benzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine (CAS 3095-81-6) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine. InChIKey: QRZWEROLVZUPJH-KQQUZDAGSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-[(E)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenyl]ethenyl]pyridine |
| InChIKey | QRZWEROLVZUPJH-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=NC=C2)/C=C/C3=CC=NC=C3 |
Computed by PubChem (NCBI)