Products 2758677-57-3
CAS 2758677-57-3 is the registry number for [1,1'-Binaphthalene]-2,7-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-naphthalen-1-ylnaphthalene-2,7-diamine (CAS 2758677-57-3) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 1-naphthalen-1-ylnaphthalene-2,7-diamine. InChIKey: VHZUJXWBAFFHGO-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 1-naphthalen-1-ylnaphthalene-2,7-diamine |
| InChIKey | VHZUJXWBAFFHGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=C(C=CC4=C3C=C(C=C4)N)N |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Binaphthalene]-2,7-diamine