CAS 18741-85-0 appears in our catalog under these names: (R)-(+)-(1,1'-Binaphthalene)-2,2'-diamine, >95% (HPLC), (R)–(+)–1,1′–Binaphthyl–2,2′–diamine, (R)-(+)-1,1'-Bi(2-naphthylamine), 97% , (R)-(+)-2,2'-Diamino-1,1'-binaphthalene, (R)-(+)-1,1'-Binaphthyl-2,2'-diamine, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 2,5g, 5g, 250mg, 2g, 200mg, 10g, 25g.
1-(2-aminonaphthalen-1-yl)naphthalen-2-amine (CAS 18741-85-0) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 1-(2-aminonaphthalen-1-yl)naphthalen-2-amine. InChIKey: DDAPSNKEOHDLKB-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 1-(2-aminonaphthalen-1-yl)naphthalen-2-amine |
| InChIKey | DDAPSNKEOHDLKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)N)N |
Computed by PubChem (NCBI)