CAS 64235-43-4 is the registry number for (R)-[1,1'-Binaphthalene]-4,4'-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-aminonaphthalen-1-yl)naphthalen-1-amine (CAS 64235-43-4) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: 4-(4-aminonaphthalen-1-yl)naphthalen-1-amine. InChIKey: RZPBZEISZUFQSV-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 4-(4-aminonaphthalen-1-yl)naphthalen-1-amine |
| InChIKey | RZPBZEISZUFQSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2N)C3=CC=C(C4=CC=CC=C43)N |
Computed by PubChem (NCBI)