Products 1461704-84-6
CAS 1461704-84-6 is the registry number for 2-Phenyl-octahydroimidazolidino(1,5-a)piperazine-1,3-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione;hydrochloride (CAS 1461704-84-6) is a chemical compound with the molecular formula C12H14ClN3O2 and a molecular weight of 267.71 g/mol. IUPAC name: 2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione;hydrochloride. InChIKey: UNTYHSGQDYWHTR-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | 2-phenyl-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyrazine-1,3-dione;hydrochloride |
| InChIKey | UNTYHSGQDYWHTR-UHFFFAOYSA-N |
| SMILES | C1CN2C(CN1)C(=O)N(C2=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)