CAS 1461709-36-3 appears in our catalog under these names: 8-Chloro-5-methoxy-2-methylquinoline hydrochloride, 95%, 8-Chloro-5-methoxy-2-methylquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
8-chloro-5-methoxy-2-methylquinoline;hydrochloride (CAS 1461709-36-3) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: 8-chloro-5-methoxy-2-methylquinoline;hydrochloride. InChIKey: LEHFDVYXPCSLJT-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 8-chloro-5-methoxy-2-methylquinoline;hydrochloride |
| InChIKey | LEHFDVYXPCSLJT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2C=C1)OC)Cl.Cl |
Computed by PubChem (NCBI)