Products 1462-89-1

CAS 1462-89-1 is the registry number for Ethyl 5-nitro-nicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 5-nitropyridine-3-carboxylate (CAS 1462-89-1) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: ethyl 5-nitropyridine-3-carboxylate. InChIKey: DMCBVKXZBZVCTD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8N2O4
Molecular weight196.16 g/mol
IUPAC nameethyl 5-nitropyridine-3-carboxylate
InChIKeyDMCBVKXZBZVCTD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=CN=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)