CAS 146322-08-9 appears in our catalog under these names: alpha-Methyl-1,3-benzodioxole-5-propanal Oxime, MDA 2–aldoxime analog, MMDPPO. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 5g, 1mg, 5mg, 50mg, Get quote.
(NE)-N-[3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]hydroxylamine (CAS 146322-08-9) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: (NE)-N-[3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]hydroxylamine. InChIKey: ISLHQWBNLXYVQG-WUXMJOGZSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (NE)-N-[3-(1,3-benzodioxol-5-yl)-2-methylpropylidene]hydroxylamine |
| InChIKey | ISLHQWBNLXYVQG-WUXMJOGZSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCO2)/C=N/O |
Computed by PubChem (NCBI)