CAS 1466028-83-0 is the registry number for 4,6-Dichloro-2-cyclobutyl-5-ethylpyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,6-dichloro-2-cyclobutyl-5-ethylpyrimidine (CAS 1466028-83-0) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: 4,6-dichloro-2-cyclobutyl-5-ethylpyrimidine. InChIKey: VOSFRYBCWGKUOA-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 4,6-dichloro-2-cyclobutyl-5-ethylpyrimidine |
| InChIKey | VOSFRYBCWGKUOA-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(N=C1Cl)C2CCC2)Cl |
Computed by PubChem (NCBI)