CAS 1466112-77-5 is the registry number for 5-Methyl-2-(2,4,6-trifluorophenyl)oxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-(2,4,6-trifluorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 1466112-77-5) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-methyl-2-(2,4,6-trifluorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: AFVVQXQATWFBQM-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 5-methyl-2-(2,4,6-trifluorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | AFVVQXQATWFBQM-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=C(C=C(C=C2F)F)F)C(=O)O |
Computed by PubChem (NCBI)