CAS 1466429-31-1 appears in our catalog under these names: (1R)-7-fluoro-1,2,3,4-tetra hydronaphthalen-1-amine hcl, 95%, (1R)-7-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, (1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 95%, (R)-7-Fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2,5g, 100mg.
(1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1466429-31-1) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: STIGKSYKJSYOOT-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (1R)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | STIGKSYKJSYOOT-HNCPQSOCSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC(=C2)F)N.Cl |
Computed by PubChem (NCBI)