Products 146692-91-3

CAS 146692-91-3 is the registry number for H-DL-Asp(OtBu)-OH 98%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 146692-91-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: 2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: MXWMFBYWXMXRPD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO4
Molecular weight189.21 g/mol
IUPAC name2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid
InChIKeyMXWMFBYWXMXRPD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)CC(C(=O)O)N

Computed by PubChem (NCBI)