CAS 64960-75-4 appears in our catalog under these names: H–D–Asp(OtBu)–OH, H-D-Asp(OtBu)-OH*H2O, D-Aspartic acid b tert-butyl ester, H-D-Asp(OtBu)-OH 98%, H-D-Asp(OtBu)-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 50g, 100g, 250g, 1g, 5 g.
(2R)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 64960-75-4) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2R)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: MXWMFBYWXMXRPD-RXMQYKEDSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2R)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | MXWMFBYWXMXRPD-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)