CAS 3057-74-7 appears in our catalog under these names: L-Aspartic Acid 4-tert-Butyl Ester, >95% (HPLC), H–Asp(OtBu)–OH, H-L-Asp(OtBu)-OH, L-Aspartic acid 4-tert-butyl ester, 98% , 4-tert-Butyl L-Aspartate, >98.0%(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 10g, 50g, 250g.
(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 3057-74-7) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: MXWMFBYWXMXRPD-YFKPBYRVSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | MXWMFBYWXMXRPD-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)