Products 1467060-38-3
CAS 1467060-38-3 is the registry number for 3-(4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenyl)oxetan-3-ol, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]oxetan-3-ol (CAS 1467060-38-3) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]oxetan-3-ol. InChIKey: IDBJBBHRBBMYLW-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]oxetan-3-ol |
| InChIKey | IDBJBBHRBBMYLW-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C3(COC3)O |
Computed by PubChem (NCBI)