CAS 14686-65-8 appears in our catalog under these names: 1,5–Dihydroxyxanthone, 1,5-Dihydroxyxanthone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 2mg, 1mg, 10mg, 25mg, Get quote.
1,5-dihydroxyxanthen-9-one (CAS 14686-65-8) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 1,5-dihydroxyxanthen-9-one. InChIKey: APIPFXZYOMIJQG-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 1,5-dihydroxyxanthen-9-one |
| InChIKey | APIPFXZYOMIJQG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC3=CC=CC(=C3C2=O)O |
Computed by PubChem (NCBI)