Products 174023-48-4

CAS 174023-48-4 appears in our catalog under these names: Iuro-a, 95%, Isourolithin A, Isourolithin A, 97%, Isourolithin A/ 98.25% (existing batch purity), 3,9–Dihydroxy–6H–benzo(c)chromen–6–one. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 250mg, 1g, 10mg, 25mg, 1mg, 5mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

3,9-dihydroxybenzo[c]chromen-6-one (CAS 174023-48-4) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 3,9-dihydroxybenzo[c]chromen-6-one. InChIKey: WDGSXHQNUPZEHA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8O4
Molecular weight228.20 g/mol
IUPAC name3,9-dihydroxybenzo[c]chromen-6-one
InChIKeyWDGSXHQNUPZEHA-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1O)C3=C(C=C(C=C3)O)OC2=O

Computed by PubChem (NCBI)