CAS 174023-48-4 appears in our catalog under these names: Iuro-a, 95%, Isourolithin A, Isourolithin A, 97%, Isourolithin A/ 98.25% (existing batch purity), 3,9–Dihydroxy–6H–benzo(c)chromen–6–one. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 250mg, 1g, 10mg, 25mg, 1mg, 5mg, 50mg, 100mg.
3,9-dihydroxybenzo[c]chromen-6-one (CAS 174023-48-4) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 3,9-dihydroxybenzo[c]chromen-6-one. InChIKey: WDGSXHQNUPZEHA-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 3,9-dihydroxybenzo[c]chromen-6-one |
| InChIKey | WDGSXHQNUPZEHA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C3=C(C=C(C=C3)O)OC2=O |
Computed by PubChem (NCBI)