CAS 947499-34-5 is the registry number for 7,9-Dihydroxy-6H-benzo[c]chromen-6-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7,9-dihydroxybenzo[c]chromen-6-one (CAS 947499-34-5) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 7,9-dihydroxybenzo[c]chromen-6-one. InChIKey: QNSQJQPZUOYRMV-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 7,9-dihydroxybenzo[c]chromen-6-one |
| InChIKey | QNSQJQPZUOYRMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=CC(=C3)O)O)C(=O)O2 |
Computed by PubChem (NCBI)