CAS 35040-32-5 appears in our catalog under these names: 2,5–Dihydroxyxanthone, 2,5-Dihydroxyxanthone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
2,5-dihydroxyxanthen-9-one (CAS 35040-32-5) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 2,5-dihydroxyxanthen-9-one. InChIKey: LXSIVSWCSPREMS-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2,5-dihydroxyxanthen-9-one |
| InChIKey | LXSIVSWCSPREMS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)