CAS 591212-74-7 is the registry number for 5-(3-Oxo-1,3-dihydro-2-benzofuran-5-yl)-2-furaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-carbaldehyde (CAS 591212-74-7) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-carbaldehyde. InChIKey: FIOXJOBCBWJAGW-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 5-(3-oxo-1H-2-benzofuran-5-yl)furan-2-carbaldehyde |
| InChIKey | FIOXJOBCBWJAGW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C3=CC=C(O3)C=O)C(=O)O1 |
Computed by PubChem (NCBI)