CAS 1601489-88-6 is the registry number for 4,8-Dihydroxy-6H-benzo[c]chromen-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-dihydroxybenzo[c]chromen-6-one (CAS 1601489-88-6) is a chemical compound with the molecular formula C13H8O4 and a molecular weight of 228.20 g/mol. IUPAC name: 4,8-dihydroxybenzo[c]chromen-6-one. InChIKey: RQCIOPIDAACJPK-UHFFFAOYSA-N.
| Molecular formula | C13H8O4 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 4,8-dihydroxybenzo[c]chromen-6-one |
| InChIKey | RQCIOPIDAACJPK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C3=C2C=CC(=C3)O |
Computed by PubChem (NCBI)