CAS 146953-81-3 is the registry number for Boc-(15N)Leu-OH. Offered by: Creative Peptides. Available pack sizes: 100mg, 250mg, 1g.
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]pentanoic acid (CAS 146953-81-3) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 232.28 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]pentanoic acid. InChIKey: MDXGYYOJGPFFJL-CNTRYBNASA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]pentanoic acid |
| InChIKey | MDXGYYOJGPFFJL-CNTRYBNASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)[15NH]C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)