CAS 16937-99-8 appears in our catalog under these names: N-Boc-D-leucine, Boc–D–Leu–OH·H2O, Boc-D-Leu-OH • H2O, Boc-D-Leu-OH, BOC-D-Leucine monohydrate, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100g, 10g, 25g, 500g, 1g, 5g, 50g, 250g.
(2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 16937-99-8) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: MDXGYYOJGPFFJL-MRVPVSSYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | MDXGYYOJGPFFJL-MRVPVSSYSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)