Products 1469802-29-6
CAS 1469802-29-6 appears in our catalog under these names: H-Trp(7-CN)-OH 98%, (S)-2-Amino-3-(7-cyano-1H-indol-3-yl)propanoic acid, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-2-amino-3-(7-cyano-1H-indol-3-yl)propanoic acid (CAS 1469802-29-6) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: (2S)-2-amino-3-(7-cyano-1H-indol-3-yl)propanoic acid. InChIKey: FJGPUTWOJHMELC-JTQLQIEISA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2S)-2-amino-3-(7-cyano-1H-indol-3-yl)propanoic acid |
| InChIKey | FJGPUTWOJHMELC-JTQLQIEISA-N |
| SMILES | C1=CC(=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)N)C#N |
Computed by PubChem (NCBI)