CAS 147219-20-3 appears in our catalog under these names: (2E)-3-(3,4-Dimethylphenyl)acrylic acid, 95%, (2E)-3-(3,4-dimethylphenyl)prop-2-enoic acid, (2E)-3-(3,4-DIMETHYLPHENYL)ACRYLIC ACID, 97%, 97%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 2g, 50mg.
(E)-3-(3,4-dimethylphenyl)prop-2-enoic acid (CAS 147219-20-3) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(3,4-dimethylphenyl)prop-2-enoic acid. InChIKey: FUVFAUBWEXSLEY-AATRIKPKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(3,4-dimethylphenyl)prop-2-enoic acid |
| InChIKey | FUVFAUBWEXSLEY-AATRIKPKSA-N |
| SMILES | CC1=C(C=C(C=C1)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)