CAS 14773-40-1 is the registry number for Istradefylline Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3,4-dimethoxyphenyl)prop-2-enamide (CAS 14773-40-1) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)prop-2-enamide. InChIKey: QUKZILHYXHKAKT-GQCTYLIASA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| InChIKey | QUKZILHYXHKAKT-GQCTYLIASA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)N)OC |
Computed by PubChem (NCBI)