CAS 14785-95-6 appears in our catalog under these names: 6-Amino-5-formylamino-1-methyluracil, Linagliptin Impurity 74. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
N-(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)formamide (CAS 14785-95-6) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: N-(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)formamide. InChIKey: WIORCHCZQJVXLD-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | N-(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)formamide |
| InChIKey | WIORCHCZQJVXLD-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)NC1=O)NC=O)N |
Computed by PubChem (NCBI)