CAS 220459-24-5 is the registry number for 3-(3-Amino-5-oxo-4,5-dihydro-1,2,4-triazin-6-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)propanoic acid (CAS 220459-24-5) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: 3-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)propanoic acid. InChIKey: FUPLOPZRMXCXPC-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)propanoic acid |
| InChIKey | FUPLOPZRMXCXPC-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C1=NN=C(NC1=O)N |
Computed by PubChem (NCBI)