CAS 50996-15-1 is the registry number for N-(6-Amino-3-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)formamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)formamide (CAS 50996-15-1) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)formamide. InChIKey: PFMKSQSGPSFNSJ-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)formamide |
| InChIKey | PFMKSQSGPSFNSJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(NC1=O)N)NC=O |
Computed by PubChem (NCBI)