CAS 58537-55-6 appears in our catalog under these names: Uracil Impurity 3, 5-(hydroxyimino)-6-imino-1,3-dimethyldihydropyrimidine-2,4(1H,3H)-dione, Uracil Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-amino-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione (CAS 58537-55-6) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: 6-amino-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione. InChIKey: MGBDANYXBKROBW-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 6-amino-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione |
| InChIKey | MGBDANYXBKROBW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)N=O)N |
Computed by PubChem (NCBI)