CAS 869942-33-6 is the registry number for [5-(Acetylamino)-1h-1,2,4-triazol-3-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-acetamido-1H-1,2,4-triazol-5-yl)acetic acid (CAS 869942-33-6) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: 2-(3-acetamido-1H-1,2,4-triazol-5-yl)acetic acid. InChIKey: JLZNHGWFLBIENS-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2-(3-acetamido-1H-1,2,4-triazol-5-yl)acetic acid |
| InChIKey | JLZNHGWFLBIENS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NNC(=N1)CC(=O)O |
Computed by PubChem (NCBI)