CAS 60728-92-9 is the registry number for 4-(3-Nitro-1h-1,2,4-triazol-1-yl)butan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(3-nitro-1,2,4-triazol-1-yl)butan-2-one (CAS 60728-92-9) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: 4-(3-nitro-1,2,4-triazol-1-yl)butan-2-one. InChIKey: TVOPQTRZSBLUNV-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 4-(3-nitro-1,2,4-triazol-1-yl)butan-2-one |
| InChIKey | TVOPQTRZSBLUNV-UHFFFAOYSA-N |
| SMILES | CC(=O)CCN1C=NC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)