Products 1480461-04-8

CAS 1480461-04-8 is the registry number for 2-Amino-3-(4,5-dimethyl-4H-1,2,4-triazol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-3-(4,5-dimethyl-1,2,4-triazol-3-yl)propanoic acid (CAS 1480461-04-8) is a chemical compound with the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. IUPAC name: 2-amino-3-(4,5-dimethyl-1,2,4-triazol-3-yl)propanoic acid. InChIKey: XSTXXIMMDFHXKW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12N4O2
Molecular weight184.20 g/mol
IUPAC name2-amino-3-(4,5-dimethyl-1,2,4-triazol-3-yl)propanoic acid
InChIKeyXSTXXIMMDFHXKW-UHFFFAOYSA-N
SMILESCC1=NN=C(N1C)CC(C(=O)O)N

Computed by PubChem (NCBI)