CAS 148050-69-5 appears in our catalog under these names: 6,7-Dihydroxy-1-oxo-2,3-dihydro-1H-indene-4-carboxylic acid, 98%, 98%, 6,7-Dihydroxy-1-oxo-2,3-dihydro-1H-indene-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6,7-dihydroxy-1-oxo-2,3-dihydroindene-4-carboxylic acid (CAS 148050-69-5) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 6,7-dihydroxy-1-oxo-2,3-dihydroindene-4-carboxylic acid. InChIKey: SVQPYDSJBWIOJK-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 6,7-dihydroxy-1-oxo-2,3-dihydroindene-4-carboxylic acid |
| InChIKey | SVQPYDSJBWIOJK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2O)O)C(=O)O |
Computed by PubChem (NCBI)