CAS 2108497-01-2 is the registry number for 2-((3-Hydroxybenzoyl)oxy)acrylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(3-hydroxybenzoyl)oxyprop-2-enoic acid (CAS 2108497-01-2) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 2-(3-hydroxybenzoyl)oxyprop-2-enoic acid. InChIKey: FNKUMPYFKZBGAV-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-(3-hydroxybenzoyl)oxyprop-2-enoic acid |
| InChIKey | FNKUMPYFKZBGAV-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)O)OC(=O)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)