Products 2243506-89-8

CAS 2243506-89-8 is the registry number for 2,5-Dioxo-5,6,7,8-tetrahydro-2H-chromene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2,5-dioxo-7,8-dihydro-6H-chromene-3-carboxylic acid (CAS 2243506-89-8) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 2,5-dioxo-7,8-dihydro-6H-chromene-3-carboxylic acid. InChIKey: KSPRPEOSTOJENO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O5
Molecular weight208.17 g/mol
IUPAC name2,5-dioxo-7,8-dihydro-6H-chromene-3-carboxylic acid
InChIKeyKSPRPEOSTOJENO-UHFFFAOYSA-N
SMILESC1CC2=C(C=C(C(=O)O2)C(=O)O)C(=O)C1

Computed by PubChem (NCBI)