CAS 360789-45-3 is the registry number for 2-(4-(Methoxycarbonyl)phenyl)-2-oxoacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methoxycarbonylphenyl)-2-oxoacetic acid (CAS 360789-45-3) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 2-(4-methoxycarbonylphenyl)-2-oxoacetic acid. InChIKey: QWCDHPUMLPCZIO-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-(4-methoxycarbonylphenyl)-2-oxoacetic acid |
| InChIKey | QWCDHPUMLPCZIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)C(=O)O |
Computed by PubChem (NCBI)