Products 360789-45-3

CAS 360789-45-3 is the registry number for 2-(4-(Methoxycarbonyl)phenyl)-2-oxoacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-methoxycarbonylphenyl)-2-oxoacetic acid (CAS 360789-45-3) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 2-(4-methoxycarbonylphenyl)-2-oxoacetic acid. InChIKey: QWCDHPUMLPCZIO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O5
Molecular weight208.17 g/mol
IUPAC name2-(4-methoxycarbonylphenyl)-2-oxoacetic acid
InChIKeyQWCDHPUMLPCZIO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C(=O)C(=O)O

Computed by PubChem (NCBI)