CAS 157530-74-0 is the registry number for Methyl 2-(3H-benzo(C)(1,2)dioxol-6-yl)-2-oxoacetate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Methyl 2-(1,3-benzodioxol-5-yl)-2-oxoacetate (CAS 157530-74-0) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: methyl 2-(1,3-benzodioxol-5-yl)-2-oxoacetate. InChIKey: PYOCVBMVWWVLFP-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | methyl 2-(1,3-benzodioxol-5-yl)-2-oxoacetate |
| InChIKey | PYOCVBMVWWVLFP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)