CAS 4821-94-7 appears in our catalog under these names: 5,6-Dimethoxyisobenzofuran-1,3-dione, 95-<97%, 5,6-Dimethoxyisobenzofuran-1,3-dione, ≥97-<99%, 4,5–diMethoxy–phthalic anhydride, 5,6-dimethoxyisobenzofuran-1,3-dione, 5,6-Dimethoxyisobenzofuran-1,3-dione 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 100mg, 1g.
5,6-dimethoxy-2-benzofuran-1,3-dione (CAS 4821-94-7) is a chemical compound with the molecular formula C10H8O5 and a molecular weight of 208.17 g/mol. IUPAC name: 5,6-dimethoxy-2-benzofuran-1,3-dione. InChIKey: IMSDRBDUANUSRL-UHFFFAOYSA-N.
| Molecular formula | C10H8O5 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 5,6-dimethoxy-2-benzofuran-1,3-dione |
| InChIKey | IMSDRBDUANUSRL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)OC2=O)OC |
Computed by PubChem (NCBI)