Products 1480997-68-9
CAS 1480997-68-9 is the registry number for 3-(2-Chloro-6-nitrophenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2-chloro-6-nitrophenyl)propanoic acid (CAS 1480997-68-9) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 3-(2-chloro-6-nitrophenyl)propanoic acid. InChIKey: GMWQQPOJBMEQMH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 3-(2-chloro-6-nitrophenyl)propanoic acid |
| InChIKey | GMWQQPOJBMEQMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)